C30H27N3O4 — CID 60576721
N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzamide (PubChem CID 60576721) has the molecular formula C30H27N3O4 and a molecular weight of 493.56 g/mol. Its IUPAC name is N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzamide.
| Compound Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzamide |
|---|---|
| PubChem CID | 60576721 |
| Molecular Formula | C30H27N3O4 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzamide |
| SMILES | CCC1(c2ccc(NC(=O)c3ccccc3-c3ncc(-c4ccc(C)cc4)o3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C30H27N3O4/c1-3-30(17-16-26(34)33-29(30)36)21-12-14-22(15-13-21)32-27(35)23-6-4-5-7-24(23)28-31-18-25(37-28)20-10-8-19(2)9-11-20/h4-15,18H,3,16-17H2,1-2H3,(H,32,35)(H,33,34,36) |
| InChIKey | OZIYSIIZCWELOT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|