C15H17IN2O4 — CID 146489185
iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate (PubChem CID 146489185) has the molecular formula C15H17IN2O4 and a molecular weight of 416.22 g/mol. Its IUPAC name is iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate.
| Compound Name | iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 146489185 |
| Molecular Formula | C15H17IN2O4 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate |
| SMILES | CCC1(c2ccc(NC(=O)OCI)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C15H17IN2O4/c1-2-15(8-7-12(19)18-13(15)20)10-3-5-11(6-4-10)17-14(21)22-9-16/h3-6H,2,7-9H2,1H3,(H,17,21)(H,18,19,20) |
| InChIKey | UHSOOLZEEBNHPN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|