About iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate
iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate (PubChem CID 146489185) has the molecular formula C15H17IN2O4
and a molecular weight of 416.22 g/mol. Its IUPAC name is iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate.
Molecular Properties
| Compound Name | iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate |
| PubChem CID | 146489185 |
| Molecular Formula | C15H17IN2O4 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate |
| SMILES | CCC1(c2ccc(NC(=O)OCI)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C15H17IN2O4/c1-2-15(8-7-12(19)18-13(15)20)10-3-5-11(6-4-10)17-14(21)22-9-16/h3-6H,2,7-9H2,1H3,(H,17,21)(H,18,19,20) |
| InChIKey | UHSOOLZEEBNHPN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate?
The IUPAC name of iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate (CID 146489185) is iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate.
What is the SMILES notation for iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate?
The canonical SMILES for iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate is CCC1(c2ccc(NC(=O)OCI)cc2)CCC(=O)NC1=O.
What is the InChIKey of iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate?
The InChIKey is UHSOOLZEEBNHPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17IN2O4/c1-2-15(8-7-12(19)18-13(15)20)10-3-5-11(6-4-10)17-14(21)22-9-16/h3-6H,2,7-9H2,1H3,(H,17,21)(H,18,19,20).
What are the key properties of iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate?
iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate has a molecular weight of 416.22 g/mol, XLogP of 2.71, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iodomethyl N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]carbamate is sourced from PubChem (CID 146489185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).