C19H19N3O4 — CID 60570520
N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 60570520) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 60570520 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | CCC1(c2ccc(NC(=O)c3cc[n+]([O-])cc3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C19H19N3O4/c1-2-19(10-7-16(23)21-18(19)25)14-3-5-15(6-4-14)20-17(24)13-8-11-22(26)12-9-13/h3-6,8-9,11-12H,2,7,10H2,1H3,(H,20,24)(H,21,23,25) |
| InChIKey | QWWBUPMUYBYRLS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|