C20H19ClN2O3 — CID 41025293
4-chloro-N-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]benzamide (PubChem CID 41025293) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is 4-chloro-N-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]benzamide.
| Compound Name | 4-chloro-N-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 41025293 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4-chloro-N-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]benzamide |
| SMILES | CC[C@]1(c2ccc(NC(=O)c3ccc(Cl)cc3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C20H19ClN2O3/c1-2-20(12-11-17(24)23-19(20)26)14-5-9-16(10-6-14)22-18(25)13-3-7-15(21)8-4-13/h3-10H,2,11-12H2,1H3,(H,22,25)(H,23,24,26)/t20-/m1/s1 |
| InChIKey | QNWYQGIHZUHMMU-HXUWFJFHSA-N |
| XLogP | 3.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|