C22H20Cl2N2O3 — CID 76869654
3-(3,4-dichlorophenyl)-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]prop-2-enamide (PubChem CID 76869654) has the molecular formula C22H20Cl2N2O3 and a molecular weight of 431.32 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76869654 |
| Molecular Formula | C22H20Cl2N2O3 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]prop-2-enamide |
| SMILES | CCC1(c2ccc(NC(=O)C=Cc3ccc(Cl)c(Cl)c3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C22H20Cl2N2O3/c1-2-22(12-11-20(28)26-21(22)29)15-5-7-16(8-6-15)25-19(27)10-4-14-3-9-17(23)18(24)13-14/h3-10,13H,2,11-12H2,1H3,(H,25,27)(H,26,28,29) |
| InChIKey | LFKKHTWMQSKZIH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|