C24H28N2O3 — CID 60570734
3-(2,4-dimethylphenyl)-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]propanamide (PubChem CID 60570734) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]propanamide.
| Compound Name | 3-(2,4-dimethylphenyl)-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 60570734 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]propanamide |
| SMILES | CCC1(c2ccc(NC(=O)CCc3ccc(C)cc3C)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C24H28N2O3/c1-4-24(14-13-22(28)26-23(24)29)19-8-10-20(11-9-19)25-21(27)12-7-18-6-5-16(2)15-17(18)3/h5-6,8-11,15H,4,7,12-14H2,1-3H3,(H,25,27)(H,26,28,29) |
| InChIKey | CMFMWGIWRZFVPJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|