C23H25N5O3 — CID 60570837
N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 60570837) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 60570837 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | CCC1(c2ccc(NC(=O)c3cc(C)nc4c3c(C)nn4C)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C23H25N5O3/c1-5-23(11-10-18(29)26-22(23)31)15-6-8-16(9-7-15)25-21(30)17-12-13(2)24-20-19(17)14(3)27-28(20)4/h6-9,12H,5,10-11H2,1-4H3,(H,25,30)(H,26,29,31) |
| InChIKey | DAAURVCKQZCDHI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|