C23H22ClFN2O3 — CID 99810327
cis-(1R,2S)-2-(2-chloro-6-fluorophenyl)-N-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]cyclopropane-1-carboxamide (PubChem CID 99810327) has the molecular formula C23H22ClFN2O3 and a molecular weight of 428.89 g/mol. Its IUPAC name is cis-(1R,2S)-2-(2-chloro-6-fluorophenyl)-N-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-(2-chloro-6-fluorophenyl)-N-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 99810327 |
| Molecular Formula | C23H22ClFN2O3 |
| Molecular Weight | 428.89 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | cis-(1R,2S)-2-(2-chloro-6-fluorophenyl)-N-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]cyclopropane-1-carboxamide |
| SMILES | CC[C@]1(c2ccc(NC(=O)[C@@H]3C[C@@H]3c3c(F)cccc3Cl)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C23H22ClFN2O3/c1-2-23(11-10-19(28)27-22(23)30)13-6-8-14(9-7-13)26-21(29)16-12-15(16)20-17(24)4-3-5-18(20)25/h3-9,15-16H,2,10-12H2,1H3,(H,26,29)(H,27,28,30)/t15-,16+,23+/m0/s1 |
| InChIKey | GJHJNHXEWYFLRL-NXHTTZLHSA-N |
| XLogP | 4.31 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.89 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|