C24H27N3O6S — CID 52909973
3-(cyclopropylsulfamoyl)-N-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-4-methoxybenzamide (PubChem CID 52909973) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-N-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-4-methoxybenzamide.
| Compound Name | 3-(cyclopropylsulfamoyl)-N-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 52909973 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-N-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-4-methoxybenzamide |
| SMILES | CC[C@]1(c2ccc(NC(=O)c3ccc(OC)c(S(=O)(=O)NC4CC4)c3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C24H27N3O6S/c1-3-24(13-12-21(28)26-23(24)30)16-5-7-17(8-6-16)25-22(29)15-4-11-19(33-2)20(14-15)34(31,32)27-18-9-10-18/h4-8,11,14,18,27H,3,9-10,12-13H2,1-2H3,(H,25,29)(H,26,28,30)/t24-/m1/s1 |
| InChIKey | VQQLNSNGSJJERR-XMMPIXPASA-N |
| XLogP | 2.47 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|