C25H21N3O4S — CID 60570843
5-(1,3-benzothiazol-2-yl)-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]furan-2-carboxamide (PubChem CID 60570843) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 60570843 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]furan-2-carboxamide |
| SMILES | CCC1(c2ccc(NC(=O)c3ccc(-c4nc5ccccc5s4)o3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C25H21N3O4S/c1-2-25(14-13-21(29)28-24(25)31)15-7-9-16(10-8-15)26-22(30)18-11-12-19(32-18)23-27-17-5-3-4-6-20(17)33-23/h3-12H,2,13-14H2,1H3,(H,26,30)(H,28,29,31) |
| InChIKey | KDWQQZRYBXRULB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|