C16H9ClN2O4 — CID 134019812
5-chloro-N-(2-oxo-3H-1,3-benzoxazol-5-yl)-1-benzofuran-2-carboxamide (PubChem CID 134019812) has the molecular formula C16H9ClN2O4 and a molecular weight of 328.71 g/mol. Its IUPAC name is 5-chloro-N-(2-oxo-3H-1,3-benzoxazol-5-yl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-(2-oxo-3H-1,3-benzoxazol-5-yl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 134019812 |
| Molecular Formula | C16H9ClN2O4 |
| Molecular Weight | 328.71 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 5-chloro-N-(2-oxo-3H-1,3-benzoxazol-5-yl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc2oc(=O)[nH]c2c1)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C16H9ClN2O4/c17-9-1-3-12-8(5-9)6-14(22-12)15(20)18-10-2-4-13-11(7-10)19-16(21)23-13/h1-7H,(H,18,20)(H,19,21) |
| InChIKey | KYQIQSBLJYNKKD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |