C19H12ClNO2S2 — CID 8897974
(4-chloronaphthalen-1-yl) 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate (PubChem CID 8897974) has the molecular formula C19H12ClNO2S2 and a molecular weight of 385.90 g/mol. Its IUPAC name is (4-chloronaphthalen-1-yl) 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate.
| Compound Name | (4-chloronaphthalen-1-yl) 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 8897974 |
| Molecular Formula | C19H12ClNO2S2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | (4-chloronaphthalen-1-yl) 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate |
| SMILES | O=C(Cc1csc(-c2cccs2)n1)Oc1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C19H12ClNO2S2/c20-15-7-8-16(14-5-2-1-4-13(14)15)23-18(22)10-12-11-25-19(21-12)17-6-3-9-24-17/h1-9,11H,10H2 |
| InChIKey | BYRRMOLYCJTRMM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|