About [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate
[4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate (PubChem CID 7921898) has the molecular formula C20H19NO5S2
and a molecular weight of 417.51 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate.
Molecular Properties
| Compound Name | [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate |
| PubChem CID | 7921898 |
| Molecular Formula | C20H19NO5S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate |
| SMILES | COc1ccc(S(=O)(=O)N(C)c2ccc(OC(=O)Cc3cccs3)cc2)cc1 |
| InChI | InChI=1S/C20H19NO5S2/c1-21(28(23,24)19-11-9-16(25-2)10-12-19)15-5-7-17(8-6-15)26-20(22)14-18-4-3-13-27-18/h3-13H,14H2,1-2H3 |
| InChIKey | LEDRJKKCUKHQML-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate?
The IUPAC name of [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate (CID 7921898) is [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate.
What is the SMILES notation for [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate?
The canonical SMILES for [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate is COc1ccc(S(=O)(=O)N(C)c2ccc(OC(=O)Cc3cccs3)cc2)cc1.
What is the InChIKey of [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate?
The InChIKey is LEDRJKKCUKHQML-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO5S2/c1-21(28(23,24)19-11-9-16(25-2)10-12-19)15-5-7-17(8-6-15)26-20(22)14-18-4-3-13-27-18/h3-13H,14H2,1-2H3.
What are the key properties of [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate?
[4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate has a molecular weight of 417.51 g/mol, XLogP of 3.73, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 2-thiophen-2-ylacetate is sourced from PubChem (CID 7921898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).