C15H12Cl2N2O3S — CID 27826070
(3,4-dichlorophenyl) 2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetate (PubChem CID 27826070) has the molecular formula C15H12Cl2N2O3S and a molecular weight of 371.25 g/mol. Its IUPAC name is (3,4-dichlorophenyl) 2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetate.
| Compound Name | (3,4-dichlorophenyl) 2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 27826070 |
| Molecular Formula | C15H12Cl2N2O3S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | (3,4-dichlorophenyl) 2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetate |
| SMILES | O=C(Cc1csc(N2CCCC2=O)n1)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2N2O3S/c16-11-4-3-10(7-12(11)17)22-14(21)6-9-8-23-15(18-9)19-5-1-2-13(19)20/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | CNCAMFSRNATDON-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|