C18H18N2O4S — CID 35545606
[4-(2-oxopyrrolidin-1-yl)phenyl] 3-(thiophene-2-carbonylamino)propanoate (PubChem CID 35545606) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 3-(thiophene-2-carbonylamino)propanoate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 3-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 35545606 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 3-(thiophene-2-carbonylamino)propanoate |
| SMILES | O=C(CCNC(=O)c1cccs1)Oc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H18N2O4S/c21-16-4-1-11-20(16)13-5-7-14(8-6-13)24-17(22)9-10-19-18(23)15-3-2-12-25-15/h2-3,5-8,12H,1,4,9-11H2,(H,19,23) |
| InChIKey | MUDGPIFUWBRKJK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|