C23H20N2O4S — CID 32981938
[4-(thiophene-2-carbonylamino)phenyl] 4-(2-oxopiperidin-1-yl)benzoate (PubChem CID 32981938) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 4-(2-oxopiperidin-1-yl)benzoate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 4-(2-oxopiperidin-1-yl)benzoate |
|---|---|
| PubChem CID | 32981938 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 4-(2-oxopiperidin-1-yl)benzoate |
| SMILES | O=C(Oc1ccc(NC(=O)c2cccs2)cc1)c1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C23H20N2O4S/c26-21-5-1-2-14-25(21)18-10-6-16(7-11-18)23(28)29-19-12-8-17(9-13-19)24-22(27)20-4-3-15-30-20/h3-4,6-13,15H,1-2,5,14H2,(H,24,27) |
| InChIKey | BNRJAJKUUHLIRR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|