C49H34N2O12 — CID 158988199
[4-[2-[3,5-bis[(4-phenoxycarbonyloxybenzoyl)amino]phenyl]-2-oxoethyl]phenyl] phenyl carbonate (PubChem CID 158988199) has the molecular formula C49H34N2O12 and a molecular weight of 842.81 g/mol. Its IUPAC name is [4-[2-[3,5-bis[(4-phenoxycarbonyloxybenzoyl)amino]phenyl]-2-oxoethyl]phenyl] phenyl carbonate.
| Compound Name | [4-[2-[3,5-bis[(4-phenoxycarbonyloxybenzoyl)amino]phenyl]-2-oxoethyl]phenyl] phenyl carbonate |
|---|---|
| PubChem CID | 158988199 |
| Molecular Formula | C49H34N2O12 |
| Molecular Weight | 842.81 g/mol |
| Exact Mass | 842.21 |
| IUPAC Name | [4-[2-[3,5-bis[(4-phenoxycarbonyloxybenzoyl)amino]phenyl]-2-oxoethyl]phenyl] phenyl carbonate |
| SMILES | O=C(Oc1ccccc1)Oc1ccc(CC(=O)c2cc(NC(=O)c3ccc(OC(=O)Oc4ccccc4)cc3)cc(NC(=O)c3ccc(OC(=O)Oc4ccccc4)cc3)c2)cc1 |
| InChI | InChI=1S/C49H34N2O12/c52-44(28-32-16-22-41(23-17-32)61-47(55)58-38-10-4-1-5-11-38)35-29-36(50-45(53)33-18-24-42(25-19-33)62-48(56)59-39-12-6-2-7-13-39)31-37(30-35)51-46(54)34-20-26-43(27-21-34)63-49(57)60-40-14-8-3-9-15-40/h1-27,29-31H,28H2,(H,50,53)(H,51,54) |
| InChIKey | XSNCHNQFVCRGPH-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 181.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.81 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|