C16H12FN3O2S — CID 51114332
N-[(4-fluorophenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 51114332) has the molecular formula C16H12FN3O2S and a molecular weight of 329.36 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 51114332 |
| Molecular Formula | C16H12FN3O2S |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc2c(=O)[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C16H12FN3O2S/c17-11-4-1-9(2-5-11)8-18-14(21)10-3-6-12-13(7-10)19-16(23)20-15(12)22/h1-7H,8H2,(H,18,21)(H2,19,20,22,23) |
| InChIKey | MTIPIFYTOPWVIQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|