C17H13F2N3O3S — CID 75414966
N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 75414966) has the molecular formula C17H13F2N3O3S and a molecular weight of 377.37 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 75414966 |
| Molecular Formula | C17H13F2N3O3S |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | O=C(NCC(O)c1ccc(F)c(F)c1)c1ccc2c(=O)[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C17H13F2N3O3S/c18-11-4-2-8(5-12(11)19)14(23)7-20-15(24)9-1-3-10-13(6-9)21-17(26)22-16(10)25/h1-6,14,23H,7H2,(H,20,24)(H2,21,22,25,26) |
| InChIKey | OHENZBBBHDCJHR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|