C18H15F2N3O3S — CID 51115908
N-[1-[4-(difluoromethoxy)phenyl]ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 51115908) has the molecular formula C18H15F2N3O3S and a molecular weight of 391.40 g/mol. Its IUPAC name is N-[1-[4-(difluoromethoxy)phenyl]ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[1-[4-(difluoromethoxy)phenyl]ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 51115908 |
| Molecular Formula | C18H15F2N3O3S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-[1-[4-(difluoromethoxy)phenyl]ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | CC(NC(=O)c1ccc2c(=O)[nH]c(=S)[nH]c2c1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H15F2N3O3S/c1-9(10-2-5-12(6-3-10)26-17(19)20)21-15(24)11-4-7-13-14(8-11)22-18(27)23-16(13)25/h2-9,17H,1H3,(H,21,24)(H2,22,23,25,27) |
| InChIKey | DWTPEMULRCYNDC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|