C16H14BrF2NO2 — CID 7948910
N-[(1R)-1-(4-bromophenyl)ethyl]-4-(difluoromethoxy)benzamide (PubChem CID 7948910) has the molecular formula C16H14BrF2NO2 and a molecular weight of 370.19 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromophenyl)ethyl]-4-(difluoromethoxy)benzamide.
| Compound Name | N-[(1R)-1-(4-bromophenyl)ethyl]-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 7948910 |
| Molecular Formula | C16H14BrF2NO2 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | N-[(1R)-1-(4-bromophenyl)ethyl]-4-(difluoromethoxy)benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(OC(F)F)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14BrF2NO2/c1-10(11-2-6-13(17)7-3-11)20-15(21)12-4-8-14(9-5-12)22-16(18)19/h2-10,16H,1H3,(H,20,21)/t10-/m1/s1 |
| InChIKey | UXPSBYMNNYMMRZ-SNVBAGLBSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |