C18H14F3N3O2S — CID 95157040
4-oxo-2-sulfanylidene-N-[(1R)-3,3,3-trifluoro-1-phenylpropyl]-1H-quinazoline-7-carboxamide (PubChem CID 95157040) has the molecular formula C18H14F3N3O2S and a molecular weight of 393.39 g/mol. Its IUPAC name is 4-oxo-2-sulfanylidene-N-[(1R)-3,3,3-trifluoro-1-phenylpropyl]-1H-quinazoline-7-carboxamide.
| Compound Name | 4-oxo-2-sulfanylidene-N-[(1R)-3,3,3-trifluoro-1-phenylpropyl]-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 95157040 |
| Molecular Formula | C18H14F3N3O2S |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 4-oxo-2-sulfanylidene-N-[(1R)-3,3,3-trifluoro-1-phenylpropyl]-1H-quinazoline-7-carboxamide |
| SMILES | O=C(N[C@H](CC(F)(F)F)c1ccccc1)c1ccc2c(=O)[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C18H14F3N3O2S/c19-18(20,21)9-14(10-4-2-1-3-5-10)22-15(25)11-6-7-12-13(8-11)23-17(27)24-16(12)26/h1-8,14H,9H2,(H,22,25)(H2,23,24,26,27)/t14-/m1/s1 |
| InChIKey | NOSIXYVQSAUYOI-CQSZACIVSA-N |
| XLogP | 4.01 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|