C19H12F2N4O2S2 — CID 78875424
N-[5-[(3,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 78875424) has the molecular formula C19H12F2N4O2S2 and a molecular weight of 430.46 g/mol. Its IUPAC name is N-[5-[(3,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[5-[(3,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 78875424 |
| Molecular Formula | C19H12F2N4O2S2 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | N-[5-[(3,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | O=C(Nc1ncc(Cc2ccc(F)c(F)c2)s1)c1ccc2c(=O)[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C19H12F2N4O2S2/c20-13-4-1-9(6-14(13)21)5-11-8-22-19(29-11)25-16(26)10-2-3-12-15(7-10)23-18(28)24-17(12)27/h1-4,6-8H,5H2,(H,22,25,26)(H2,23,24,27,28) |
| InChIKey | WWXPVOGHBGGVNC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|