C27H19ClN4O3S — CID 4024687
3-[5-(4-chlorophenyl)furan-2-yl]-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 4024687) has the molecular formula C27H19ClN4O3S and a molecular weight of 514.99 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)furan-2-yl]-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4024687 |
| Molecular Formula | C27H19ClN4O3S |
| Molecular Weight | 514.99 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1cc(-c2nc3ncccc3o2)ccc1NC(=S)NC(=O)C=Cc1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C27H19ClN4O3S/c1-16-15-18(26-32-25-23(35-26)3-2-14-29-25)6-11-21(16)30-27(36)31-24(33)13-10-20-9-12-22(34-20)17-4-7-19(28)8-5-17/h2-15H,1H3,(H2,30,31,33,36) |
| InChIKey | YEPUXBZHPLUYLW-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.99 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|