C25H15Cl2N3O3 — CID 17052743
(E)-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]prop-2-enamide (PubChem CID 17052743) has the molecular formula C25H15Cl2N3O3 and a molecular weight of 476.32 g/mol. Its IUPAC name is (E)-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17052743 |
| Molecular Formula | C25H15Cl2N3O3 |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | (E)-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)ccc2Cl)o1)Nc1ccc(-c2nc3ncccc3o2)cc1 |
| InChI | InChI=1S/C25H15Cl2N3O3/c26-16-5-10-20(27)19(14-16)21-11-8-18(32-21)9-12-23(31)29-17-6-3-15(4-7-17)25-30-24-22(33-25)2-1-13-28-24/h1-14H,(H,29,31)/b12-9+ |
| InChIKey | PYZIMGFTNGAFML-FMIVXFBMSA-N |
| XLogP | 7.11 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|