C26H17N5O5S — CID 4268018
3-[5-(2-nitrophenyl)furan-2-yl]-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 4268018) has the molecular formula C26H17N5O5S and a molecular weight of 511.52 g/mol. Its IUPAC name is 3-[5-(2-nitrophenyl)furan-2-yl]-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(2-nitrophenyl)furan-2-yl]-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4268018 |
| Molecular Formula | C26H17N5O5S |
| Molecular Weight | 511.52 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | 3-[5-(2-nitrophenyl)furan-2-yl]-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2ccccc2[N+](=O)[O-])o1)NC(=S)Nc1ccc(-c2nc3ncccc3o2)cc1 |
| InChI | InChI=1S/C26H17N5O5S/c32-23(14-12-18-11-13-21(35-18)19-4-1-2-5-20(19)31(33)34)29-26(37)28-17-9-7-16(8-10-17)25-30-24-22(36-25)6-3-15-27-24/h1-15H,(H2,28,29,32,37) |
| InChIKey | HRPBRUTUTQCPET-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 136.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|