C23H16N4O4S — CID 1345336
N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 1345336) has the molecular formula C23H16N4O4S and a molecular weight of 444.47 g/mol. Its IUPAC name is N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1345336 |
| Molecular Formula | C23H16N4O4S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)NC(=S)Nc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C23H16N4O4S/c28-21(13-8-15-4-3-5-18(14-15)27(29)30)26-23(32)24-17-11-9-16(10-12-17)22-25-19-6-1-2-7-20(19)31-22/h1-14H,(H2,24,26,28,32) |
| InChIKey | KGZPDJULIGJAQD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|