C17H10F6N2O3S — CID 4273653
N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 4273653) has the molecular formula C17H10F6N2O3S and a molecular weight of 436.33 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4273653 |
| Molecular Formula | C17H10F6N2O3S |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H10F6N2O3S/c18-16(19,20)9-4-10(17(21,22)23)6-11(5-9)24-15(29)25-14(26)8-1-2-12-13(3-8)28-7-27-12/h1-6H,7H2,(H2,24,25,26,29) |
| InChIKey | ZPFJVDMPQKWYEC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|