C18H18N2O4 — CID 90524778
2,3-dimethoxy-N-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)benzamide (PubChem CID 90524778) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2,3-dimethoxy-N-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)benzamide.
| Compound Name | 2,3-dimethoxy-N-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 90524778 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2,3-dimethoxy-N-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc3c(c2)C(=O)NCC3)c1OC |
| InChI | InChI=1S/C18H18N2O4/c1-23-15-5-3-4-13(16(15)24-2)18(22)20-12-7-6-11-8-9-19-17(21)14(11)10-12/h3-7,10H,8-9H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | IISAGSSUJAPPRB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |