C19H21N3O5 — CID 90524965
1-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 90524965) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 1-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 90524965 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2ccc3c(c2)C(=O)NCC3)cc(OC)c1OC |
| InChI | InChI=1S/C19H21N3O5/c1-25-15-9-13(10-16(26-2)17(15)27-3)22-19(24)21-12-5-4-11-6-7-20-18(23)14(11)8-12/h4-5,8-10H,6-7H2,1-3H3,(H,20,23)(H2,21,22,24) |
| InChIKey | HIRYCGPQUMHUHE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |