C15H20N2O2 — CID 90524707
2-ethyl-N-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)butanamide (PubChem CID 90524707) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-ethyl-N-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)butanamide.
| Compound Name | 2-ethyl-N-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)butanamide |
|---|---|
| PubChem CID | 90524707 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-ethyl-N-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)butanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc2c(c1)C(=O)NCC2 |
| InChI | InChI=1S/C15H20N2O2/c1-3-10(4-2)14(18)17-12-6-5-11-7-8-16-15(19)13(11)9-12/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | FCVKHZIETSODPJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |