C23H22N2O5 — CID 171909752
2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)propanamide (PubChem CID 171909752) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)propanamide.
| Compound Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)propanamide |
|---|---|
| PubChem CID | 171909752 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)propanamide |
| SMILES | CCc1cc(=O)oc2cc(OC(C)C(=O)Nc3ccc4c(c3)C(=O)NCC4)ccc12 |
| InChI | InChI=1S/C23H22N2O5/c1-3-14-10-21(26)30-20-12-17(6-7-18(14)20)29-13(2)22(27)25-16-5-4-15-8-9-24-23(28)19(15)11-16/h4-7,10-13H,3,8-9H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | QITVVMSNMRNCFV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|