C18H19ClN4O3 — CID 86862600
2-[[4-[acetyl(methyl)amino]phenyl]carbamoylamino]-N-(4-chlorophenyl)acetamide (PubChem CID 86862600) has the molecular formula C18H19ClN4O3 and a molecular weight of 374.83 g/mol. Its IUPAC name is 2-[[4-[acetyl(methyl)amino]phenyl]carbamoylamino]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[[4-[acetyl(methyl)amino]phenyl]carbamoylamino]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 86862600 |
| Molecular Formula | C18H19ClN4O3 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-[[4-[acetyl(methyl)amino]phenyl]carbamoylamino]-N-(4-chlorophenyl)acetamide |
| SMILES | CC(=O)N(C)c1ccc(NC(=O)NCC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H19ClN4O3/c1-12(24)23(2)16-9-7-15(8-10-16)22-18(26)20-11-17(25)21-14-5-3-13(19)4-6-14/h3-10H,11H2,1-2H3,(H,21,25)(H2,20,22,26) |
| InChIKey | FJVQJBOGFIGYFO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |