C18H18ClN3O2S — CID 17234503
4-[[2-(4-chlorophenyl)acetyl]carbamothioylamino]-N-ethylbenzamide (PubChem CID 17234503) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is 4-[[2-(4-chlorophenyl)acetyl]carbamothioylamino]-N-ethylbenzamide.
| Compound Name | 4-[[2-(4-chlorophenyl)acetyl]carbamothioylamino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 17234503 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 4-[[2-(4-chlorophenyl)acetyl]carbamothioylamino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(NC(=S)NC(=O)Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H18ClN3O2S/c1-2-20-17(24)13-5-9-15(10-6-13)21-18(25)22-16(23)11-12-3-7-14(19)8-4-12/h3-10H,2,11H2,1H3,(H,20,24)(H2,21,22,23,25) |
| InChIKey | OXSMEVHSARHTKZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|