C25H22FN5O3S2 — CID 141297100
7-[4-[2-aminoethyl-[(2-phenylacetyl)carbamothioyl]amino]-2-fluorophenoxy]thieno[3,2-b]pyridine-2-carboxamide (PubChem CID 141297100) has the molecular formula C25H22FN5O3S2 and a molecular weight of 523.62 g/mol. Its IUPAC name is 7-[4-[2-aminoethyl-[(2-phenylacetyl)carbamothioyl]amino]-2-fluorophenoxy]thieno[3,2-b]pyridine-2-carboxamide.
| Compound Name | 7-[4-[2-aminoethyl-[(2-phenylacetyl)carbamothioyl]amino]-2-fluorophenoxy]thieno[3,2-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 141297100 |
| Molecular Formula | C25H22FN5O3S2 |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 7-[4-[2-aminoethyl-[(2-phenylacetyl)carbamothioyl]amino]-2-fluorophenoxy]thieno[3,2-b]pyridine-2-carboxamide |
| SMILES | NCCN(C(=S)NC(=O)Cc1ccccc1)c1ccc(Oc2ccnc3cc(C(N)=O)sc23)c(F)c1 |
| InChI | InChI=1S/C25H22FN5O3S2/c26-17-13-16(31(11-9-27)25(35)30-22(32)12-15-4-2-1-3-5-15)6-7-19(17)34-20-8-10-29-18-14-21(24(28)33)36-23(18)20/h1-8,10,13-14H,9,11-12,27H2,(H2,28,33)(H,30,32,35) |
| InChIKey | FBAOYXPABVGUTA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|