C34H36F2N4O6S — CID 87305608
N-[[3-fluoro-4-[7-[3-[4-(hydroxymethyl)piperidin-1-yl]propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-sulfanylcarbamoyl]-2-(4-fluorophenyl)acetamide (PubChem CID 87305608) has the molecular formula C34H36F2N4O6S and a molecular weight of 666.75 g/mol. Its IUPAC name is N-[[3-fluoro-4-[7-[3-[4-(hydroxymethyl)piperidin-1-yl]propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-sulfanylcarbamoyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[[3-fluoro-4-[7-[3-[4-(hydroxymethyl)piperidin-1-yl]propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-sulfanylcarbamoyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 87305608 |
| Molecular Formula | C34H36F2N4O6S |
| Molecular Weight | 666.75 g/mol |
| Exact Mass | 666.23 |
| IUPAC Name | N-[[3-fluoro-4-[7-[3-[4-(hydroxymethyl)piperidin-1-yl]propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-sulfanylcarbamoyl]-2-(4-fluorophenyl)acetamide |
| SMILES | COc1cc2c(Oc3ccc(N(S)C(=O)NC(=O)Cc4ccc(F)cc4)cc3F)ccnc2cc1OCCCN1CCC(CO)CC1 |
| InChI | InChI=1S/C34H36F2N4O6S/c1-44-31-19-26-28(20-32(31)45-16-2-13-39-14-10-23(21-41)11-15-39)37-12-9-29(26)46-30-8-7-25(18-27(30)36)40(47)34(43)38-33(42)17-22-3-5-24(35)6-4-22/h3-9,12,18-20,23,41,47H,2,10-11,13-17,21H2,1H3,(H,38,42,43) |
| InChIKey | FWGUHIAOEUWYCC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.75 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|