C34H36FN5O3S — CID 118612148
N-[[3-fluoro-4-[[6-methoxy-7-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methoxy]quinolin-4-yl]amino]phenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 118612148) has the molecular formula C34H36FN5O3S and a molecular weight of 613.76 g/mol. Its IUPAC name is N-[[3-fluoro-4-[[6-methoxy-7-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methoxy]quinolin-4-yl]amino]phenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-[[6-methoxy-7-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methoxy]quinolin-4-yl]amino]phenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 118612148 |
| Molecular Formula | C34H36FN5O3S |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | N-[[3-fluoro-4-[[6-methoxy-7-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methoxy]quinolin-4-yl]amino]phenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | COc1cc2c(Nc3ccc(NC(=S)NC(=O)Cc4ccccc4)cc3F)ccnc2cc1OCC1CC2CN(C)CC2C1 |
| InChI | InChI=1S/C34H36FN5O3S/c1-40-18-23-12-22(13-24(23)19-40)20-43-32-17-30-26(16-31(32)42-2)28(10-11-36-30)38-29-9-8-25(15-27(29)35)37-34(44)39-33(41)14-21-6-4-3-5-7-21/h3-11,15-17,22-24H,12-14,18-20H2,1-2H3,(H,36,38)(H2,37,39,41,44) |
| InChIKey | WLCRACPYTPDSIP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|