C25H22ClN5O3S — CID 118612183
N-[[5-chloro-6-[(6,7-dimethoxyquinolin-4-yl)amino]-3-pyridinyl]carbamothioyl]-2-phenylacetamide (PubChem CID 118612183) has the molecular formula C25H22ClN5O3S and a molecular weight of 508.00 g/mol. Its IUPAC name is N-[[5-chloro-6-[(6,7-dimethoxyquinolin-4-yl)amino]-3-pyridinyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[5-chloro-6-[(6,7-dimethoxyquinolin-4-yl)amino]-3-pyridinyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 118612183 |
| Molecular Formula | C25H22ClN5O3S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | N-[[5-chloro-6-[(6,7-dimethoxyquinolin-4-yl)amino]-3-pyridinyl]carbamothioyl]-2-phenylacetamide |
| SMILES | COc1cc2nccc(Nc3ncc(NC(=S)NC(=O)Cc4ccccc4)cc3Cl)c2cc1OC |
| InChI | InChI=1S/C25H22ClN5O3S/c1-33-21-12-17-19(8-9-27-20(17)13-22(21)34-2)30-24-18(26)11-16(14-28-24)29-25(35)31-23(32)10-15-6-4-3-5-7-15/h3-9,11-14H,10H2,1-2H3,(H,27,28,30)(H2,29,31,32,35) |
| InChIKey | BLTUGRWLMXEQFM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|