C20H18ClN3O6 — CID 11177946
ethyl 2-[[5-chloro-6-(6,7-dimethoxyquinolin-4-yl)oxy-3-pyridinyl]amino]-2-oxoacetate (PubChem CID 11177946) has the molecular formula C20H18ClN3O6 and a molecular weight of 431.83 g/mol. Its IUPAC name is ethyl 2-[[5-chloro-6-(6,7-dimethoxyquinolin-4-yl)oxy-3-pyridinyl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[5-chloro-6-(6,7-dimethoxyquinolin-4-yl)oxy-3-pyridinyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 11177946 |
| Molecular Formula | C20H18ClN3O6 |
| Molecular Weight | 431.83 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | ethyl 2-[[5-chloro-6-(6,7-dimethoxyquinolin-4-yl)oxy-3-pyridinyl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cnc(Oc2ccnc3cc(OC)c(OC)cc23)c(Cl)c1 |
| InChI | InChI=1S/C20H18ClN3O6/c1-4-29-20(26)18(25)24-11-7-13(21)19(23-10-11)30-15-5-6-22-14-9-17(28-3)16(27-2)8-12(14)15/h5-10H,4H2,1-3H3,(H,24,25) |
| InChIKey | CFDWHWDHOAYIHA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.83 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|