C21H19NO7 — CID 155671428
ethyl 2-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-hydroxyphenyl]-2-oxoacetate (PubChem CID 155671428) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is ethyl 2-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-hydroxyphenyl]-2-oxoacetate.
| Compound Name | ethyl 2-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-hydroxyphenyl]-2-oxoacetate |
|---|---|
| PubChem CID | 155671428 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | ethyl 2-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-hydroxyphenyl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1ccc(Oc2ccnc3cc(OC)c(OC)cc23)cc1O |
| InChI | InChI=1S/C21H19NO7/c1-4-28-21(25)20(24)13-6-5-12(9-16(13)23)29-17-7-8-22-15-11-19(27-3)18(26-2)10-14(15)17/h5-11,23H,4H2,1-3H3 |
| InChIKey | CMSXKNHMZDJJSE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|