C26H31FN4O5S — CID 155184804
S-[2-[5-[4-[2-fluoro-4-(methylamino)phenoxy]-6-methoxyquinolin-7-yl]oxypentylamino]-2-oxoethyl] 2-aminoethanethioate (PubChem CID 155184804) has the molecular formula C26H31FN4O5S and a molecular weight of 530.62 g/mol. Its IUPAC name is S-[2-[5-[4-[2-fluoro-4-(methylamino)phenoxy]-6-methoxyquinolin-7-yl]oxypentylamino]-2-oxoethyl] 2-aminoethanethioate.
| Compound Name | S-[2-[5-[4-[2-fluoro-4-(methylamino)phenoxy]-6-methoxyquinolin-7-yl]oxypentylamino]-2-oxoethyl] 2-aminoethanethioate |
|---|---|
| PubChem CID | 155184804 |
| Molecular Formula | C26H31FN4O5S |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | S-[2-[5-[4-[2-fluoro-4-(methylamino)phenoxy]-6-methoxyquinolin-7-yl]oxypentylamino]-2-oxoethyl] 2-aminoethanethioate |
| SMILES | CNc1ccc(Oc2ccnc3cc(OCCCCCNC(=O)CSC(=O)CN)c(OC)cc23)c(F)c1 |
| InChI | InChI=1S/C26H31FN4O5S/c1-29-17-6-7-22(19(27)12-17)36-21-8-10-30-20-14-24(23(34-2)13-18(20)21)35-11-5-3-4-9-31-25(32)16-37-26(33)15-28/h6-8,10,12-14,29H,3-5,9,11,15-16,28H2,1-2H3,(H,31,32) |
| InChIKey | GURVAZZXOPTBRU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|