C33H35FN4O5S2 — CID 155184974
N-[3-fluoro-4-[6-methoxy-7-[5-[[2-(pyridin-2-yldisulfanyl)acetyl]amino]pentoxy]quinolin-4-yl]oxyphenyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 155184974) has the molecular formula C33H35FN4O5S2 and a molecular weight of 650.80 g/mol. Its IUPAC name is N-[3-fluoro-4-[6-methoxy-7-[5-[[2-(pyridin-2-yldisulfanyl)acetyl]amino]pentoxy]quinolin-4-yl]oxyphenyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | N-[3-fluoro-4-[6-methoxy-7-[5-[[2-(pyridin-2-yldisulfanyl)acetyl]amino]pentoxy]quinolin-4-yl]oxyphenyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 155184974 |
| Molecular Formula | C33H35FN4O5S2 |
| Molecular Weight | 650.80 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | N-[3-fluoro-4-[6-methoxy-7-[5-[[2-(pyridin-2-yldisulfanyl)acetyl]amino]pentoxy]quinolin-4-yl]oxyphenyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4(C)CC4)cc3F)ccnc2cc1OCCCCCNC(=O)CSSc1ccccn1 |
| InChI | InChI=1S/C33H35FN4O5S2/c1-33(12-13-33)32(40)38-22-9-10-27(24(34)18-22)43-26-11-16-35-25-20-29(28(41-2)19-23(25)26)42-17-7-3-5-14-36-30(39)21-44-45-31-8-4-6-15-37-31/h4,6,8-11,15-16,18-20H,3,5,7,12-14,17,21H2,1-2H3,(H,36,39)(H,38,40) |
| InChIKey | RZGAIKKTUZWQAF-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.80 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|