C34H32ClFLiN3O7 — CID 139415422
lithium 7-[4-[4-[[1-[(3-chlorophenyl)carbamoyl]cyclopropanecarbonyl]amino]-2-fluorophenoxy]-6-methoxyquinolin-7-yl]oxyheptanoate (PubChem CID 139415422) has the molecular formula C34H32ClFLiN3O7 and a molecular weight of 656.04 g/mol. Its IUPAC name is lithium 7-[4-[4-[[1-[(3-chlorophenyl)carbamoyl]cyclopropanecarbonyl]amino]-2-fluorophenoxy]-6-methoxyquinolin-7-yl]oxyheptanoate.
| Compound Name | lithium 7-[4-[4-[[1-[(3-chlorophenyl)carbamoyl]cyclopropanecarbonyl]amino]-2-fluorophenoxy]-6-methoxyquinolin-7-yl]oxyheptanoate |
|---|---|
| PubChem CID | 139415422 |
| Molecular Formula | C34H32ClFLiN3O7 |
| Molecular Weight | 656.04 g/mol |
| Exact Mass | 655.21 |
| IUPAC Name | lithium 7-[4-[4-[[1-[(3-chlorophenyl)carbamoyl]cyclopropanecarbonyl]amino]-2-fluorophenoxy]-6-methoxyquinolin-7-yl]oxyheptanoate |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4(C(=O)Nc5cccc(Cl)c5)CC4)cc3F)ccnc2cc1OCCCCCCC(=O)[O-].[Li+] |
| InChI | InChI=1S/C34H33ClFN3O7.Li/c1-44-29-19-24-26(20-30(29)45-16-5-3-2-4-9-31(40)41)37-15-12-27(24)46-28-11-10-23(18-25(28)36)39-33(43)34(13-14-34)32(42)38-22-8-6-7-21(35)17-22;/h6-8,10-12,15,17-20H,2-5,9,13-14,16H2,1H3,(H,38,42)(H,39,43)(H,40,41);/q;+1/p-1 |
| InChIKey | VGPHWIIEYWZLAX-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 138.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.04 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|