C26H26FN3O3S2 — CID 162673794
N'-benzylsulfonyl-N-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)hexanimidamide (PubChem CID 162673794) has the molecular formula C26H26FN3O3S2 and a molecular weight of 511.64 g/mol. Its IUPAC name is N'-benzylsulfonyl-N-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)hexanimidamide.
| Compound Name | N'-benzylsulfonyl-N-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)hexanimidamide |
|---|---|
| PubChem CID | 162673794 |
| Molecular Formula | C26H26FN3O3S2 |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | N'-benzylsulfonyl-N-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)hexanimidamide |
| SMILES | CCCCC/C(=N\S(=O)(=O)Cc1ccccc1)Nc1ccc(Oc2ccnc3ccsc23)c(F)c1 |
| InChI | InChI=1S/C26H26FN3O3S2/c1-2-3-5-10-25(30-35(31,32)18-19-8-6-4-7-9-19)29-20-11-12-23(21(27)17-20)33-24-13-15-28-22-14-16-34-26(22)24/h4,6-9,11-17H,2-3,5,10,18H2,1H3,(H,29,30) |
| InChIKey | SGDLGPOJPFSIAR-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|