C20H14FN3O2S3 — CID 86604181
N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-thiophen-2-ylacetamide (PubChem CID 86604181) has the molecular formula C20H14FN3O2S3 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 86604181 |
| Molecular Formula | C20H14FN3O2S3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NC(=S)Nc1ccc(Oc2ccnc3ccsc23)c(F)c1 |
| InChI | InChI=1S/C20H14FN3O2S3/c21-14-10-12(23-20(27)24-18(25)11-13-2-1-8-28-13)3-4-16(14)26-17-5-7-22-15-6-9-29-19(15)17/h1-10H,11H2,(H2,23,24,25,27) |
| InChIKey | UCOJCRFSQLLUJI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|