C24H17ClFN3O3S — CID 24983543
1-(4-chlorophenyl)-N-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 24983543) has the molecular formula C24H17ClFN3O3S and a molecular weight of 481.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 24983543 |
| Molecular Formula | C24H17ClFN3O3S |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccnc3ccsc23)c(F)c1)C1CCN(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H17ClFN3O3S/c25-14-1-4-16(5-2-14)29-11-8-17(24(29)31)23(30)28-15-3-6-20(18(26)13-15)32-21-7-10-27-19-9-12-33-22(19)21/h1-7,9-10,12-13,17H,8,11H2,(H,28,30) |
| InChIKey | OSIHGXKVBUVAMA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|