C27H22FN3O5 — CID 45274413
N-[3-fluoro-4-(7-methoxyquinolin-4-yl)oxyphenyl]-3-oxo-4-phenylmorpholine-2-carboxamide (PubChem CID 45274413) has the molecular formula C27H22FN3O5 and a molecular weight of 487.49 g/mol. Its IUPAC name is N-[3-fluoro-4-(7-methoxyquinolin-4-yl)oxyphenyl]-3-oxo-4-phenylmorpholine-2-carboxamide.
| Compound Name | N-[3-fluoro-4-(7-methoxyquinolin-4-yl)oxyphenyl]-3-oxo-4-phenylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 45274413 |
| Molecular Formula | C27H22FN3O5 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | N-[3-fluoro-4-(7-methoxyquinolin-4-yl)oxyphenyl]-3-oxo-4-phenylmorpholine-2-carboxamide |
| SMILES | COc1ccc2c(Oc3ccc(NC(=O)C4OCCN(c5ccccc5)C4=O)cc3F)ccnc2c1 |
| InChI | InChI=1S/C27H22FN3O5/c1-34-19-8-9-20-22(16-19)29-12-11-23(20)36-24-10-7-17(15-21(24)28)30-26(32)25-27(33)31(13-14-35-25)18-5-3-2-4-6-18/h2-12,15-16,25H,13-14H2,1H3,(H,30,32) |
| InChIKey | AVOHPVUAPGVLAY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|