C32H30FN5O6 — CID 89003547
(E)-3-[anilino-[(3-methyl-2-oxo-1,3-oxazolidin-5-yl)methyl]amino]-N-[3-fluoro-4-(7-methoxyquinolin-4-yl)oxyphenyl]-2-formylbut-2-enamide (PubChem CID 89003547) has the molecular formula C32H30FN5O6 and a molecular weight of 599.62 g/mol. Its IUPAC name is (E)-3-[anilino-[(3-methyl-2-oxo-1,3-oxazolidin-5-yl)methyl]amino]-N-[3-fluoro-4-(7-methoxyquinolin-4-yl)oxyphenyl]-2-formylbut-2-enamide.
| Compound Name | (E)-3-[anilino-[(3-methyl-2-oxo-1,3-oxazolidin-5-yl)methyl]amino]-N-[3-fluoro-4-(7-methoxyquinolin-4-yl)oxyphenyl]-2-formylbut-2-enamide |
|---|---|
| PubChem CID | 89003547 |
| Molecular Formula | C32H30FN5O6 |
| Molecular Weight | 599.62 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | (E)-3-[anilino-[(3-methyl-2-oxo-1,3-oxazolidin-5-yl)methyl]amino]-N-[3-fluoro-4-(7-methoxyquinolin-4-yl)oxyphenyl]-2-formylbut-2-enamide |
| SMILES | COc1ccc2c(Oc3ccc(NC(=O)/C(C=O)=C(\C)N(CC4CN(C)C(=O)O4)Nc4ccccc4)cc3F)ccnc2c1 |
| InChI | InChI=1S/C32H30FN5O6/c1-20(38(36-21-7-5-4-6-8-21)18-24-17-37(2)32(41)43-24)26(19-39)31(40)35-22-9-12-30(27(33)15-22)44-29-13-14-34-28-16-23(42-3)10-11-25(28)29/h4-16,19,24,36H,17-18H2,1-3H3,(H,35,40)/b26-20+ |
| InChIKey | MAGZLKIDYJHJNC-LHLOQNFPSA-N |
| XLogP | 5.37 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.62 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|