C32H30FN3O5 — CID 46203260
1-N'-[3-fluoro-4-[7-[3-(1-hydroxycyclopropyl)propoxy]quinolin-4-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide (PubChem CID 46203260) has the molecular formula C32H30FN3O5 and a molecular weight of 555.61 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[7-[3-(1-hydroxycyclopropyl)propoxy]quinolin-4-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[7-[3-(1-hydroxycyclopropyl)propoxy]quinolin-4-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 46203260 |
| Molecular Formula | C32H30FN3O5 |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 1-N'-[3-fluoro-4-[7-[3-(1-hydroxycyclopropyl)propoxy]quinolin-4-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)C1(C(=O)Nc2ccc(Oc3ccnc4cc(OCCCC5(O)CC5)ccc34)c(F)c2)CC1 |
| InChI | InChI=1S/C32H30FN3O5/c33-25-19-22(36-30(38)32(15-16-32)29(37)35-21-5-2-1-3-6-21)7-10-28(25)41-27-11-17-34-26-20-23(8-9-24(26)27)40-18-4-12-31(39)13-14-31/h1-3,5-11,17,19-20,39H,4,12-16,18H2,(H,35,37)(H,36,38) |
| InChIKey | UOKJIYNISFMCQQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|