C37H39F2N5O6 — CID 70854122
[1-[3-[4-[2-fluoro-4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]quinolin-7-yl]oxypropyl]azetidin-3-yl] 2-(dimethylamino)propanoate (PubChem CID 70854122) has the molecular formula C37H39F2N5O6 and a molecular weight of 687.74 g/mol. Its IUPAC name is [1-[3-[4-[2-fluoro-4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]quinolin-7-yl]oxypropyl]azetidin-3-yl] 2-(dimethylamino)propanoate.
| Compound Name | [1-[3-[4-[2-fluoro-4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]quinolin-7-yl]oxypropyl]azetidin-3-yl] 2-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 70854122 |
| Molecular Formula | C37H39F2N5O6 |
| Molecular Weight | 687.74 g/mol |
| Exact Mass | 687.29 |
| IUPAC Name | [1-[3-[4-[2-fluoro-4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]quinolin-7-yl]oxypropyl]azetidin-3-yl] 2-(dimethylamino)propanoate |
| SMILES | CC(C(=O)OC1CN(CCCOc2ccc3c(Oc4ccc(NC(=O)C5(C(=O)Nc6ccc(F)cc6)CC5)cc4F)ccnc3c2)C1)N(C)C |
| InChI | InChI=1S/C37H39F2N5O6/c1-23(43(2)3)34(45)49-28-21-44(22-28)17-4-18-48-27-10-11-29-31(20-27)40-16-13-32(29)50-33-12-9-26(19-30(33)39)42-36(47)37(14-15-37)35(46)41-25-7-5-24(38)6-8-25/h5-13,16,19-20,23,28H,4,14-15,17-18,21-22H2,1-3H3,(H,41,46)(H,42,47) |
| InChIKey | BPRCEJCJDDREEB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.74 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|